C23H29ClN4O6 — CID 71542782
[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-(2-chloroethynyl)-4-hydroxy-3-(3-methylbutanoyloxy)oxolan-2-yl]methyl 3-methylbutanoate (PubChem CID 71542782) has the molecular formula C23H29ClN4O6 and a molecular weight of 492.96 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-(2-chloroethynyl)-4-hydroxy-3-(3-methylbutanoyloxy)oxolan-2-yl]methyl 3-methylbutanoate.
| Compound Name | [(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-(2-chloroethynyl)-4-hydroxy-3-(3-methylbutanoyloxy)oxolan-2-yl]methyl 3-methylbutanoate |
|---|---|
| PubChem CID | 71542782 |
| Molecular Formula | C23H29ClN4O6 |
| Molecular Weight | 492.96 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-(2-chloroethynyl)-4-hydroxy-3-(3-methylbutanoyloxy)oxolan-2-yl]methyl 3-methylbutanoate |
| SMILES | CC(C)CC(=O)OC[C@H]1O[C@@H](n2ccc3c(N)ncnc32)[C@@](O)(C#CCl)[C@@H]1OC(=O)CC(C)C |
| InChI | InChI=1S/C23H29ClN4O6/c1-13(2)9-17(29)32-11-16-19(34-18(30)10-14(3)4)23(31,6-7-24)22(33-16)28-8-5-15-20(25)26-12-27-21(15)28/h5,8,12-14,16,19,22,31H,9-11H2,1-4H3,(H2,25,26,27)/t16-,19-,22-,23-/m1/s1 |
| InChIKey | MVYZQWNVCMLUHQ-BGACZQCLSA-N |
| XLogP | 2.39 |
| TPSA | 138.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.96 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|