C16H18N4O4 — CID 89101634
[(3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-4-hydroxyoxolan-3-yl] 2-methylpropanoate (PubChem CID 89101634) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is [(3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-4-hydroxyoxolan-3-yl] 2-methylpropanoate.
| Compound Name | [(3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-4-hydroxyoxolan-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 89101634 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | [(3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-4-hydroxyoxolan-3-yl] 2-methylpropanoate |
| SMILES | C#C[C@@]1(O)[C@H](OC(=O)C(C)C)CO[C@H]1n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C16H18N4O4/c1-4-16(22)11(24-14(21)9(2)3)7-23-15(16)20-6-5-10-12(17)18-8-19-13(10)20/h1,5-6,8-9,11,15,22H,7H2,2-3H3,(H2,17,18,19)/t11-,15-,16-/m1/s1 |
| InChIKey | TXPUOBMSXJCURB-HFBAOOFYSA-N |
| XLogP | 0.47 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|