C20H30N4O5 — CID 10173067
[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-hydroxy-2-(hydroxymethyl)-4-methyloxolan-3-yl] octanoate (PubChem CID 10173067) has the molecular formula C20H30N4O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-hydroxy-2-(hydroxymethyl)-4-methyloxolan-3-yl] octanoate.
| Compound Name | [(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-hydroxy-2-(hydroxymethyl)-4-methyloxolan-3-yl] octanoate |
|---|---|
| PubChem CID | 10173067 |
| Molecular Formula | C20H30N4O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-hydroxy-2-(hydroxymethyl)-4-methyloxolan-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@@H]1[C@@H](CO)O[C@@H](n2ccc3c(N)ncnc32)[C@]1(C)O |
| InChI | InChI=1S/C20H30N4O5/c1-3-4-5-6-7-8-15(26)29-16-14(11-25)28-19(20(16,2)27)24-10-9-13-17(21)22-12-23-18(13)24/h9-10,12,14,16,19,25,27H,3-8,11H2,1-2H3,(H2,21,22,23)/t14-,16-,19-,20-/m1/s1 |
| InChIKey | HEPMYEKTTFBVQQ-BGRCLHOASA-N |
| XLogP | 1.93 |
| TPSA | 132.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|