C21H23Cl2N4O7P — CID 68919931
(2R,3R,4R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[(2R,4S)-4-(3,4-dichlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methyloxolane-3,4-diol (PubChem CID 68919931) has the molecular formula C21H23Cl2N4O7P and a molecular weight of 545.32 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[(2R,4S)-4-(3,4-dichlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[(2R,4S)-4-(3,4-dichlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 68919931 |
| Molecular Formula | C21H23Cl2N4O7P |
| Molecular Weight | 545.32 g/mol |
| Exact Mass | 544.07 |
| IUPAC Name | (2R,3R,4R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[(2R,4S)-4-(3,4-dichlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methyloxolane-3,4-diol |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](CO[P@@]2(=O)OCC[C@@H](c3ccc(Cl)c(Cl)c3)O2)O[C@H]1n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C21H23Cl2N4O7P/c1-21(29)17(28)16(33-20(21)27-6-4-12-18(24)25-10-26-19(12)27)9-32-35(30)31-7-5-15(34-35)11-2-3-13(22)14(23)8-11/h2-4,6,8,10,15-17,20,28-29H,5,7,9H2,1H3,(H2,24,25,26)/t15-,16+,17+,20+,21+,35+/m0/s1 |
| InChIKey | PSABUCOLSVANQD-XYHCMIJRSA-N |
| XLogP | 3.63 |
| TPSA | 151.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|