C24H31N6O10PS — CID 163764186
(2R,3R,4R)-2-(6-aminopurin-9-yl)-3-methyl-5-[[4-(3-morpholin-4-ylsulfonylphenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolane-3,4-diol (PubChem CID 163764186) has the molecular formula C24H31N6O10PS and a molecular weight of 626.59 g/mol. Its IUPAC name is (2R,3R,4R)-2-(6-aminopurin-9-yl)-3-methyl-5-[[4-(3-morpholin-4-ylsulfonylphenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4R)-2-(6-aminopurin-9-yl)-3-methyl-5-[[4-(3-morpholin-4-ylsulfonylphenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 163764186 |
| Molecular Formula | C24H31N6O10PS |
| Molecular Weight | 626.59 g/mol |
| Exact Mass | 626.16 |
| IUPAC Name | (2R,3R,4R)-2-(6-aminopurin-9-yl)-3-methyl-5-[[4-(3-morpholin-4-ylsulfonylphenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolane-3,4-diol |
| SMILES | C[C@@]1(O)[C@H](O)C(COP2(=O)OCCC(c3cccc(S(=O)(=O)N4CCOCC4)c3)O2)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C24H31N6O10PS/c1-24(32)20(31)18(39-23(24)30-14-28-19-21(25)26-13-27-22(19)30)12-38-41(33)37-8-5-17(40-41)15-3-2-4-16(11-15)42(34,35)29-6-9-36-10-7-29/h2-4,11,13-14,17-18,20,23,31-32H,5-10,12H2,1H3,(H2,25,26,27)/t17?,18?,20-,23-,24-,41?/m1/s1 |
| InChIKey | MAUOEQRHLJYQGZ-JWJQWKRZSA-N |
| XLogP | 0.74 |
| TPSA | 210.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.59 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|