C15H21N6O8P — CID 154009980
2-[[(2R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-(hydroxymethoxy)-4-methyloxolan-2-yl]methoxy]-4-methyl-2-oxo-1,3,2λ5-oxazaphospholidin-5-one (PubChem CID 154009980) has the molecular formula C15H21N6O8P and a molecular weight of 444.34 g/mol. Its IUPAC name is 2-[[(2R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-(hydroxymethoxy)-4-methyloxolan-2-yl]methoxy]-4-methyl-2-oxo-1,3,2λ5-oxazaphospholidin-5-one.
| Compound Name | 2-[[(2R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-(hydroxymethoxy)-4-methyloxolan-2-yl]methoxy]-4-methyl-2-oxo-1,3,2λ5-oxazaphospholidin-5-one |
|---|---|
| PubChem CID | 154009980 |
| Molecular Formula | C15H21N6O8P |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 2-[[(2R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-(hydroxymethoxy)-4-methyloxolan-2-yl]methoxy]-4-methyl-2-oxo-1,3,2λ5-oxazaphospholidin-5-one |
| SMILES | CC1NP(=O)(OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)C(C)(O)C2OCO)OC1=O |
| InChI | InChI=1S/C15H21N6O8P/c1-7-13(23)29-30(25,20-7)27-3-8-10(26-6-22)15(2,24)14(28-8)21-5-19-9-11(16)17-4-18-12(9)21/h4-5,7-8,10,14,22,24H,3,6H2,1-2H3,(H,20,25)(H2,16,17,18)/t7?,8-,10?,14-,15?,30?/m1/s1 |
| InChIKey | UEJIPJORYRZTKA-CEAUQPJMSA-N |
| XLogP | -0.95 |
| TPSA | 193.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|