C12H20N5O12P3 — CID 11168324
2-[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]ethyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid (PubChem CID 11168324) has the molecular formula C12H20N5O12P3 and a molecular weight of 519.24 g/mol. Its IUPAC name is 2-[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]ethyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid.
| Compound Name | 2-[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]ethyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid |
|---|---|
| PubChem CID | 11168324 |
| Molecular Formula | C12H20N5O12P3 |
| Molecular Weight | 519.24 g/mol |
| Exact Mass | 519.03 |
| IUPAC Name | 2-[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]ethyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](CCP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C12H20N5O12P3/c1-12(19)8(18)6(2-3-30(20,21)28-32(25,26)29-31(22,23)24)27-11(12)17-5-16-7-9(13)14-4-15-10(7)17/h4-6,8,11,18-19H,2-3H2,1H3,(H,20,21)(H,25,26)(H2,13,14,15)(H2,22,23,24)/t6-,8-,11-,12-/m1/s1 |
| InChIKey | MTEHVNUYMSNJTA-YUTYNTIBSA-N |
| XLogP | -0.78 |
| TPSA | 269.90 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.24 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|