C27H33N5O4Si — CID 70810152
(2R,5R)-2-(6-aminopurin-9-yl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyloxolane-3,4-diol (PubChem CID 70810152) has the molecular formula C27H33N5O4Si and a molecular weight of 519.68 g/mol. Its IUPAC name is (2R,5R)-2-(6-aminopurin-9-yl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyloxolane-3,4-diol.
| Compound Name | (2R,5R)-2-(6-aminopurin-9-yl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 70810152 |
| Molecular Formula | C27H33N5O4Si |
| Molecular Weight | 519.68 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | (2R,5R)-2-(6-aminopurin-9-yl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyloxolane-3,4-diol |
| SMILES | CC1(O)C(O)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C27H33N5O4Si/c1-26(2,3)37(18-11-7-5-8-12-18,19-13-9-6-10-14-19)35-15-20-22(33)27(4,34)25(36-20)32-17-31-21-23(28)29-16-30-24(21)32/h5-14,16-17,20,22,25,33-34H,15H2,1-4H3,(H2,28,29,30)/t20-,22?,25-,27?/m1/s1 |
| InChIKey | DUBHZSSHFXEANC-RXJOJHSJSA-N |
| XLogP | 1.99 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.68 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|