C13H17N5O5 — CID 154073541
(2R,3R,4R,5S)-2-(6-aminopurin-9-yl)-5-(1-hydroxy-2-methoxyethenyl)-3-methyloxolane-3,4-diol (PubChem CID 154073541) has the molecular formula C13H17N5O5 and a molecular weight of 323.31 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(6-aminopurin-9-yl)-5-(1-hydroxy-2-methoxyethenyl)-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-2-(6-aminopurin-9-yl)-5-(1-hydroxy-2-methoxyethenyl)-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 154073541 |
| Molecular Formula | C13H17N5O5 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (2R,3R,4R,5S)-2-(6-aminopurin-9-yl)-5-(1-hydroxy-2-methoxyethenyl)-3-methyloxolane-3,4-diol |
| SMILES | COC=C(O)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C13H17N5O5/c1-13(21)9(20)8(6(19)3-22-2)23-12(13)18-5-17-7-10(14)15-4-16-11(7)18/h3-5,8-9,12,19-21H,1-2H3,(H2,14,15,16)/t8-,9-,12-,13-/m1/s1 |
| InChIKey | UDDDHUKJTAXYMM-NRMKKVEVSA-N |
| XLogP | -0.54 |
| TPSA | 148.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|