C11H13N5O4 — CID 160863617
(1R,3R,4R,5R)-3-(6-aminopurin-9-yl)-4-methyl-2-oxabicyclo[3.1.0]hexane-4,5,6-triol (PubChem CID 160863617) has the molecular formula C11H13N5O4 and a molecular weight of 279.26 g/mol. Its IUPAC name is (1R,3R,4R,5R)-3-(6-aminopurin-9-yl)-4-methyl-2-oxabicyclo[3.1.0]hexane-4,5,6-triol.
| Compound Name | (1R,3R,4R,5R)-3-(6-aminopurin-9-yl)-4-methyl-2-oxabicyclo[3.1.0]hexane-4,5,6-triol |
|---|---|
| PubChem CID | 160863617 |
| Molecular Formula | C11H13N5O4 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | (1R,3R,4R,5R)-3-(6-aminopurin-9-yl)-4-methyl-2-oxabicyclo[3.1.0]hexane-4,5,6-triol |
| SMILES | C[C@]1(O)[C@H](n2cnc3c(N)ncnc32)O[C@@H]2C(O)[C@@]21O |
| InChI | InChI=1S/C11H13N5O4/c1-10(18)9(20-6-5(17)11(6,10)19)16-3-15-4-7(12)13-2-14-8(4)16/h2-3,5-6,9,17-19H,1H3,(H2,12,13,14)/t5?,6-,9-,10+,11-/m1/s1 |
| InChIKey | SKUUVQDWBLEZTO-VOUBYMNESA-N |
| XLogP | -1.84 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |