C21H22N5O5P — CID 71101930
(2R,5R)-2-(6-aminopurin-9-yl)-3-methyl-5-(naphthalen-1-yloxyphosphanyloxymethyl)oxolane-3,4-diol (PubChem CID 71101930) has the molecular formula C21H22N5O5P and a molecular weight of 455.41 g/mol. Its IUPAC name is (2R,5R)-2-(6-aminopurin-9-yl)-3-methyl-5-(naphthalen-1-yloxyphosphanyloxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,5R)-2-(6-aminopurin-9-yl)-3-methyl-5-(naphthalen-1-yloxyphosphanyloxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 71101930 |
| Molecular Formula | C21H22N5O5P |
| Molecular Weight | 455.41 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | (2R,5R)-2-(6-aminopurin-9-yl)-3-methyl-5-(naphthalen-1-yloxyphosphanyloxymethyl)oxolane-3,4-diol |
| SMILES | CC1(O)C(O)[C@@H](COPOc2cccc3ccccc23)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C21H22N5O5P/c1-21(28)17(27)15(30-20(21)26-11-25-16-18(22)23-10-24-19(16)26)9-29-32-31-14-8-4-6-12-5-2-3-7-13(12)14/h2-8,10-11,15,17,20,27-28,32H,9H2,1H3,(H2,22,23,24)/t15-,17?,20-,21?/m1/s1 |
| InChIKey | UTORBLGBILDTDT-PJCUBKEHSA-N |
| XLogP | 2.18 |
| TPSA | 137.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|