C22H26F2N5O7P — CID 71013089
(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-5-[[(2R,6S)-6-(2,3-difluorophenyl)-4,4-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methyloxolane-3,4-diol (PubChem CID 71013089) has the molecular formula C22H26F2N5O7P and a molecular weight of 541.45 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-5-[[(2R,6S)-6-(2,3-difluorophenyl)-4,4-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-5-[[(2R,6S)-6-(2,3-difluorophenyl)-4,4-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 71013089 |
| Molecular Formula | C22H26F2N5O7P |
| Molecular Weight | 541.45 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | (2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-5-[[(2R,6S)-6-(2,3-difluorophenyl)-4,4-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methyloxolane-3,4-diol |
| SMILES | CC1(C)C[C@@H](c2cccc(F)c2F)O[P@@](=O)(OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@](C)(O)[C@@H]2O)O1 |
| InChI | InChI=1S/C22H26F2N5O7P/c1-21(2)7-13(11-5-4-6-12(23)15(11)24)35-37(32,36-21)33-8-14-17(30)22(3,31)20(34-14)29-10-28-16-18(25)26-9-27-19(16)29/h4-6,9-10,13-14,17,20,30-31H,7-8H2,1-3H3,(H2,25,26,27)/t13-,14+,17+,20+,22+,37+/m0/s1 |
| InChIKey | GRTDFDWMYBPPIC-WVVBQATFSA-N |
| XLogP | 2.78 |
| TPSA | 164.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|