C20H22N7O7P — CID 71013180
5-[(2R,4S)-2-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-dioxaphosphinan-4-yl]pyridine-2-carbonitrile (PubChem CID 71013180) has the molecular formula C20H22N7O7P and a molecular weight of 503.41 g/mol. Its IUPAC name is 5-[(2R,4S)-2-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-dioxaphosphinan-4-yl]pyridine-2-carbonitrile.
| Compound Name | 5-[(2R,4S)-2-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-dioxaphosphinan-4-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 71013180 |
| Molecular Formula | C20H22N7O7P |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | 5-[(2R,4S)-2-[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-2-oxo-1,3,2λ5-dioxaphosphinan-4-yl]pyridine-2-carbonitrile |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](CO[P@@]2(=O)OCC[C@@H](c3ccc(C#N)nc3)O2)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C20H22N7O7P/c1-20(29)16(28)14(33-19(20)27-10-26-15-17(22)24-9-25-18(15)27)8-32-35(30)31-5-4-13(34-35)11-2-3-12(6-21)23-7-11/h2-3,7,9-10,13-14,16,19,28-29H,4-5,8H2,1H3,(H2,22,24,25)/t13-,14+,16+,19+,20+,35+/m0/s1 |
| InChIKey | DZYCMMBYUAJDAK-ATZLKTJFSA-N |
| XLogP | 0.99 |
| TPSA | 200.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|