C23H27ClN5O7P — CID 16757472
9-[(3aR,4R,6R,6aR)-6-[[(2S,4R)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]purin-6-amine (PubChem CID 16757472) has the molecular formula C23H27ClN5O7P and a molecular weight of 551.92 g/mol. Its IUPAC name is 9-[(3aR,4R,6R,6aR)-6-[[(2S,4R)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]purin-6-amine.
| Compound Name | 9-[(3aR,4R,6R,6aR)-6-[[(2S,4R)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]purin-6-amine |
|---|---|
| PubChem CID | 16757472 |
| Molecular Formula | C23H27ClN5O7P |
| Molecular Weight | 551.92 g/mol |
| Exact Mass | 551.13 |
| IUPAC Name | 9-[(3aR,4R,6R,6aR)-6-[[(2S,4R)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]purin-6-amine |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[P@]3(=O)OCC[C@H](c4cccc(Cl)c4)O3)O[C@@H](n3cnc4c(N)ncnc43)[C@]2(C)O1 |
| InChI | InChI=1S/C23H27ClN5O7P/c1-22(2)34-18-16(10-32-37(30)31-8-7-15(35-37)13-5-4-6-14(24)9-13)33-21(23(18,3)36-22)29-12-28-17-19(25)26-11-27-20(17)29/h4-6,9,11-12,15-16,18,21H,7-8,10H2,1-3H3,(H2,25,26,27)/t15-,16-,18-,21-,23-,37+/m1/s1 |
| InChIKey | CYRAHNAVKFGVET-MMCHOCKZSA-N |
| XLogP | 4.17 |
| TPSA | 142.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.92 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|