C21H24ClN4O7P — CID 59169601
(2R,3R,4R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[(4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methyloxolane-3,4-diol (PubChem CID 59169601) has the molecular formula C21H24ClN4O7P and a molecular weight of 510.87 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[(4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[(4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 59169601 |
| Molecular Formula | C21H24ClN4O7P |
| Molecular Weight | 510.87 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | (2R,3R,4R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[(4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methyloxolane-3,4-diol |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](COP2(=O)OCC[C@@H](c3cccc(Cl)c3)O2)O[C@H]1n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C21H24ClN4O7P/c1-21(28)17(27)16(32-20(21)26-7-5-14-18(23)24-11-25-19(14)26)10-31-34(29)30-8-6-15(33-34)12-3-2-4-13(22)9-12/h2-5,7,9,11,15-17,20,27-28H,6,8,10H2,1H3,(H2,23,24,25)/t15-,16+,17+,20+,21+,34?/m0/s1 |
| InChIKey | ZYIISXCJMXTACN-HHNFNQCISA-N |
| XLogP | 2.98 |
| TPSA | 151.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.87 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|