C21H23F2N4O7P — CID 163469154
(2R,3R,4R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[(2S,4R)-4-(2,3-difluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methyloxolane-3,4-diol (PubChem CID 163469154) has the molecular formula C21H23F2N4O7P and a molecular weight of 512.41 g/mol. Its IUPAC name is (2R,3R,4R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[(2S,4R)-4-(2,3-difluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[(2S,4R)-4-(2,3-difluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 163469154 |
| Molecular Formula | C21H23F2N4O7P |
| Molecular Weight | 512.41 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | (2R,3R,4R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[(2S,4R)-4-(2,3-difluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3-methyloxolane-3,4-diol |
| SMILES | C[C@@]1(O)[C@H](O)C(CO[P@]2(=O)OCC[C@H](c3cccc(F)c3F)O2)O[C@H]1n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C21H23F2N4O7P/c1-21(29)17(28)15(33-20(21)27-7-5-12-18(24)25-10-26-19(12)27)9-32-35(30)31-8-6-14(34-35)11-3-2-4-13(22)16(11)23/h2-5,7,10,14-15,17,20,28-29H,6,8-9H2,1H3,(H2,24,25,26)/t14-,15?,17-,20-,21-,35+/m1/s1 |
| InChIKey | BVCZOOYTUCMIHC-ZHQWVRAHSA-N |
| XLogP | 2.60 |
| TPSA | 151.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|