C20H22ClN4O7P — CID 70917652
(2R,3R,4S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[(4R)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-3-methyloxolane-3,4-diol (PubChem CID 70917652) has the molecular formula C20H22ClN4O7P and a molecular weight of 496.84 g/mol. Its IUPAC name is (2R,3R,4S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[(4R)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[(4R)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 70917652 |
| Molecular Formula | C20H22ClN4O7P |
| Molecular Weight | 496.84 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | (2R,3R,4S)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[(4R)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-3-methyloxolane-3,4-diol |
| SMILES | C[C@@]1(O)[C@H](O)C(OP2(=O)OCC[C@H](c3cccc(Cl)c3)O2)O[C@H]1n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C20H22ClN4O7P/c1-20(27)15(26)18(30-19(20)25-7-5-13-16(22)23-10-24-17(13)25)32-33(28)29-8-6-14(31-33)11-3-2-4-12(21)9-11/h2-5,7,9-10,14-15,18-19,26-27H,6,8H2,1H3,(H2,22,23,24)/t14-,15-,18?,19-,20-,33?/m1/s1 |
| InChIKey | CDGFTNWAEXJRGB-WTJGKPPRSA-N |
| XLogP | 2.94 |
| TPSA | 151.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.84 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|