C20H22BrN4O8P — CID 136631682
2-amino-7-[(2R,3R,4S)-5-[[(4S)-4-(3-bromophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-3,4-dihydroxy-3-methyloxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 136631682) has the molecular formula C20H22BrN4O8P and a molecular weight of 557.29 g/mol. Its IUPAC name is 2-amino-7-[(2R,3R,4S)-5-[[(4S)-4-(3-bromophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-3,4-dihydroxy-3-methyloxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-amino-7-[(2R,3R,4S)-5-[[(4S)-4-(3-bromophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-3,4-dihydroxy-3-methyloxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136631682 |
| Molecular Formula | C20H22BrN4O8P |
| Molecular Weight | 557.29 g/mol |
| Exact Mass | 556.04 |
| IUPAC Name | 2-amino-7-[(2R,3R,4S)-5-[[(4S)-4-(3-bromophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-3,4-dihydroxy-3-methyloxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | C[C@@]1(O)[C@H](O)C(OP2(=O)OCC[C@@H](c3cccc(Br)c3)O2)O[C@H]1n1ccc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C20H22BrN4O8P/c1-20(28)14(26)17(31-18(20)25-7-5-12-15(25)23-19(22)24-16(12)27)33-34(29)30-8-6-13(32-34)10-3-2-4-11(21)9-10/h2-5,7,9,13-14,17-18,26,28H,6,8H2,1H3,(H3,22,23,24,27)/t13-,14+,17?,18+,20+,34?/m0/s1 |
| InChIKey | AZUHYMOCNCTIOC-XZUGOHNXSA-N |
| XLogP | 2.34 |
| TPSA | 171.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|