C24H30ClFN3O9P — CID 118096913
[(2R,3R,4R,5R)-2-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] 2-amino-3-methylbutanoate (PubChem CID 118096913) has the molecular formula C24H30ClFN3O9P and a molecular weight of 589.94 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] 2-amino-3-methylbutanoate.
| Compound Name | [(2R,3R,4R,5R)-2-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 118096913 |
| Molecular Formula | C24H30ClFN3O9P |
| Molecular Weight | 589.94 g/mol |
| Exact Mass | 589.14 |
| IUPAC Name | [(2R,3R,4R,5R)-2-[[4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] 2-amino-3-methylbutanoate |
| SMILES | CC(C)C(N)C(=O)O[C@@H]1[C@@H](COP2(=O)OCCC(c3cccc(Cl)c3)O2)O[C@@H](n2ccc(=O)[nH]c2=O)[C@]1(C)F |
| InChI | InChI=1S/C24H30ClFN3O9P/c1-13(2)19(27)21(31)37-20-17(36-22(24(20,3)26)29-9-7-18(30)28-23(29)32)12-35-39(33)34-10-8-16(38-39)14-5-4-6-15(25)11-14/h4-7,9,11,13,16-17,19-20,22H,8,10,12,27H2,1-3H3,(H,28,30,32)/t16?,17-,19?,20-,22-,24-,39?/m1/s1 |
| InChIKey | KPKSFRSEDXEBFN-HLGBLANCSA-N |
| XLogP | 3.01 |
| TPSA | 161.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.94 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|