C22H25ClFN2O9P — CID 59603059
[(2R,3R,4S)-2-[[(2R,4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] propanoate (PubChem CID 59603059) has the molecular formula C22H25ClFN2O9P and a molecular weight of 546.87 g/mol. Its IUPAC name is [(2R,3R,4S)-2-[[(2R,4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] propanoate.
| Compound Name | [(2R,3R,4S)-2-[[(2R,4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] propanoate |
|---|---|
| PubChem CID | 59603059 |
| Molecular Formula | C22H25ClFN2O9P |
| Molecular Weight | 546.87 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | [(2R,3R,4S)-2-[[(2R,4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] propanoate |
| SMILES | CCC(=O)O[C@@H]1[C@@H](CO[P@@]2(=O)OCC[C@@H](c3cccc(Cl)c3)O2)OC(n2ccc(=O)[nH]c2=O)[C@@]1(C)F |
| InChI | InChI=1S/C22H25ClFN2O9P/c1-3-18(28)34-19-16(33-20(22(19,2)24)26-9-7-17(27)25-21(26)29)12-32-36(30)31-10-8-15(35-36)13-5-4-6-14(23)11-13/h4-7,9,11,15-16,19-20H,3,8,10,12H2,1-2H3,(H,25,27,29)/t15-,16+,19+,20?,22-,36+/m0/s1 |
| InChIKey | GQVKGOARWRUCOP-YLLSKMDTSA-N |
| XLogP | 3.44 |
| TPSA | 135.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.87 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|