C25H33FN3O10P — CID 156523197
[(2R,3R,4R,5R)-2-[[[[(1R)-1-(1,3-dioxolan-2-yl)propyl]amino]-phenoxyphosphoryl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] propanoate (PubChem CID 156523197) has the molecular formula C25H33FN3O10P and a molecular weight of 585.52 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-[[[[(1R)-1-(1,3-dioxolan-2-yl)propyl]amino]-phenoxyphosphoryl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] propanoate.
| Compound Name | [(2R,3R,4R,5R)-2-[[[[(1R)-1-(1,3-dioxolan-2-yl)propyl]amino]-phenoxyphosphoryl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] propanoate |
|---|---|
| PubChem CID | 156523197 |
| Molecular Formula | C25H33FN3O10P |
| Molecular Weight | 585.52 g/mol |
| Exact Mass | 585.19 |
| IUPAC Name | [(2R,3R,4R,5R)-2-[[[[(1R)-1-(1,3-dioxolan-2-yl)propyl]amino]-phenoxyphosphoryl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] propanoate |
| SMILES | CCC(=O)O[C@@H]1[C@@H](COP(=O)(N[C@H](CC)C2OCCO2)Oc2ccccc2)O[C@@H](n2ccc(=O)[nH]c2=O)[C@]1(C)F |
| InChI | InChI=1S/C25H33FN3O10P/c1-4-17(22-34-13-14-35-22)28-40(33,39-16-9-7-6-8-10-16)36-15-18-21(38-20(31)5-2)25(3,26)23(37-18)29-12-11-19(30)27-24(29)32/h6-12,17-18,21-23H,4-5,13-15H2,1-3H3,(H,28,33)(H,27,30,32)/t17-,18-,21-,23-,25-,40?/m1/s1 |
| InChIKey | NBKSGKDICKKZRG-XZNDHKTOSA-N |
| XLogP | 2.43 |
| TPSA | 156.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.52 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|