C27H37FN3O10P — CID 155408933
[(2R,3R,4R,5R)-2-[[[1-(1,3-dioxolan-2-yl)ethylamino]-phenoxyphosphoryl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] hexanoate (PubChem CID 155408933) has the molecular formula C27H37FN3O10P and a molecular weight of 613.58 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-[[[1-(1,3-dioxolan-2-yl)ethylamino]-phenoxyphosphoryl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] hexanoate.
| Compound Name | [(2R,3R,4R,5R)-2-[[[1-(1,3-dioxolan-2-yl)ethylamino]-phenoxyphosphoryl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] hexanoate |
|---|---|
| PubChem CID | 155408933 |
| Molecular Formula | C27H37FN3O10P |
| Molecular Weight | 613.58 g/mol |
| Exact Mass | 613.22 |
| IUPAC Name | [(2R,3R,4R,5R)-2-[[[1-(1,3-dioxolan-2-yl)ethylamino]-phenoxyphosphoryl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-3-yl] hexanoate |
| SMILES | CCCCCC(=O)O[C@@H]1[C@@H](COP(=O)(NC(C)C2OCCO2)Oc2ccccc2)O[C@@H](n2ccc(=O)[nH]c2=O)[C@]1(C)F |
| InChI | InChI=1S/C27H37FN3O10P/c1-4-5-7-12-22(33)40-23-20(39-25(27(23,3)28)31-14-13-21(32)29-26(31)34)17-38-42(35,41-19-10-8-6-9-11-19)30-18(2)24-36-15-16-37-24/h6,8-11,13-14,18,20,23-25H,4-5,7,12,15-17H2,1-3H3,(H,30,35)(H,29,32,34)/t18?,20-,23-,25-,27-,42?/m1/s1 |
| InChIKey | VTGPZYUCHXKTRE-XLSUGYOKSA-N |
| XLogP | 3.21 |
| TPSA | 156.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|