C14H15Cl2FN2O7 — CID 145071286
[(3R,4R)-3-(2-chloroacetyl)oxy-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-2-yl]methyl 2-chloroacetate (PubChem CID 145071286) has the molecular formula C14H15Cl2FN2O7 and a molecular weight of 413.19 g/mol. Its IUPAC name is [(3R,4R)-3-(2-chloroacetyl)oxy-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-2-yl]methyl 2-chloroacetate.
| Compound Name | [(3R,4R)-3-(2-chloroacetyl)oxy-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-2-yl]methyl 2-chloroacetate |
|---|---|
| PubChem CID | 145071286 |
| Molecular Formula | C14H15Cl2FN2O7 |
| Molecular Weight | 413.19 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | [(3R,4R)-3-(2-chloroacetyl)oxy-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyloxolan-2-yl]methyl 2-chloroacetate |
| SMILES | C[C@]1(F)C(n2ccc(=O)[nH]c2=O)OC(COC(=O)CCl)[C@H]1OC(=O)CCl |
| InChI | InChI=1S/C14H15Cl2FN2O7/c1-14(17)11(26-10(22)5-16)7(6-24-9(21)4-15)25-12(14)19-3-2-8(20)18-13(19)23/h2-3,7,11-12H,4-6H2,1H3,(H,18,20,23)/t7?,11-,12?,14-/m1/s1 |
| InChIKey | NPUPHBRCIKFYJD-HSFSRISVSA-N |
| XLogP | 0.09 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.19 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|