C10H12FIN2O5S — CID 144807349
[5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy thiohypoiodite (PubChem CID 144807349) has the molecular formula C10H12FIN2O5S and a molecular weight of 418.18 g/mol. Its IUPAC name is [5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy thiohypoiodite.
| Compound Name | [5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy thiohypoiodite |
|---|---|
| PubChem CID | 144807349 |
| Molecular Formula | C10H12FIN2O5S |
| Molecular Weight | 418.18 g/mol |
| Exact Mass | 417.95 |
| IUPAC Name | [5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy thiohypoiodite |
| SMILES | CC1(F)C(O)C(COSI)OC1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H12FIN2O5S/c1-10(11)7(16)5(4-18-20-12)19-8(10)14-3-2-6(15)13-9(14)17/h2-3,5,7-8,16H,4H2,1H3,(H,13,15,17) |
| InChIKey | FGODAXODQUHGSG-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.18 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|