C16H17FN2O7P+ — CID 134221087
[(3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium (PubChem CID 134221087) has the molecular formula C16H17FN2O7P+ and a molecular weight of 399.29 g/mol. Its IUPAC name is [(3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium.
| Compound Name | [(3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium |
|---|---|
| PubChem CID | 134221087 |
| Molecular Formula | C16H17FN2O7P+ |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | [(3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium |
| SMILES | C[C@@]1(F)[C@H](O)C(CO[P+](=O)Oc2ccccc2)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C16H16FN2O7P/c1-16(17)13(21)11(9-24-27(23)26-10-5-3-2-4-6-10)25-14(16)19-8-7-12(20)18-15(19)22/h2-8,11,13-14,21H,9H2,1H3/p+1/t11?,13-,14-,16-/m1/s1 |
| InChIKey | MLBGDRAIPLGFIV-IIIYTMRASA-O |
| XLogP | 1.28 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|