C17H15FN2O8P+ — CID 123940169
[5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-oxo-phenoxyphosphanium (PubChem CID 123940169) has the molecular formula C17H15FN2O8P+ and a molecular weight of 425.29 g/mol. Its IUPAC name is [5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-oxo-phenoxyphosphanium.
| Compound Name | [5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-oxo-phenoxyphosphanium |
|---|---|
| PubChem CID | 123940169 |
| Molecular Formula | C17H15FN2O8P+ |
| Molecular Weight | 425.29 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | [5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-oxo-phenoxyphosphanium |
| SMILES | C#CC1(O)C(n2ccc(=O)[nH]c2=O)OC(F)(CO[P+](=O)Oc2ccccc2)C1O |
| InChI | InChI=1S/C17H14FN2O8P/c1-2-16(24)13(22)17(18,10-26-29(25)28-11-6-4-3-5-7-11)27-14(16)20-9-8-12(21)19-15(20)23/h1,3-9,13-14,22,24H,10H2/p+1 |
| InChIKey | LLXAKVBBZBEQFD-UHFFFAOYSA-O |
| XLogP | 0.21 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.29 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|