C12H12F2N2O4 — CID 90251544
1-[(2R,3S,4S,5R)-3-ethynyl-3,5-difluoro-5-(hydroxymethyl)-4-methyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 90251544) has the molecular formula C12H12F2N2O4 and a molecular weight of 286.23 g/mol. Its IUPAC name is 1-[(2R,3S,4S,5R)-3-ethynyl-3,5-difluoro-5-(hydroxymethyl)-4-methyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4S,5R)-3-ethynyl-3,5-difluoro-5-(hydroxymethyl)-4-methyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90251544 |
| Molecular Formula | C12H12F2N2O4 |
| Molecular Weight | 286.23 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1-[(2R,3S,4S,5R)-3-ethynyl-3,5-difluoro-5-(hydroxymethyl)-4-methyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C#C[C@]1(F)[C@H](n2ccc(=O)[nH]c2=O)O[C@](F)(CO)[C@H]1C |
| InChI | InChI=1S/C12H12F2N2O4/c1-3-11(13)7(2)12(14,6-17)20-9(11)16-5-4-8(18)15-10(16)19/h1,4-5,7,9,17H,6H2,2H3,(H,15,18,19)/t7-,9+,11+,12+/m0/s1 |
| InChIKey | KSFMMJAONSJEAD-ZPKWADRFSA-N |
| XLogP | -0.30 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.23 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|