C11H9FN2O4 — CID 90247969
1-[(2R,3R,4R)-3-ethynyl-3-fluoro-4-hydroxy-5-methylideneoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 90247969) has the molecular formula C11H9FN2O4 and a molecular weight of 252.20 g/mol. Its IUPAC name is 1-[(2R,3R,4R)-3-ethynyl-3-fluoro-4-hydroxy-5-methylideneoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R)-3-ethynyl-3-fluoro-4-hydroxy-5-methylideneoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90247969 |
| Molecular Formula | C11H9FN2O4 |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 1-[(2R,3R,4R)-3-ethynyl-3-fluoro-4-hydroxy-5-methylideneoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C#C[C@@]1(F)[C@H](O)C(=C)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C11H9FN2O4/c1-3-11(12)8(16)6(2)18-9(11)14-5-4-7(15)13-10(14)17/h1,4-5,8-9,16H,2H2,(H,13,15,17)/t8-,9-,11-/m1/s1 |
| InChIKey | XDCAYJYENPMVAA-FXPVBKGRSA-N |
| XLogP | -0.72 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|