C14H19FN2O5 — CID 145393369
ethane;1-[3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-prop-1-ynyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 145393369) has the molecular formula C14H19FN2O5 and a molecular weight of 314.31 g/mol. Its IUPAC name is ethane;1-[3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-prop-1-ynyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | ethane;1-[3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-prop-1-ynyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 145393369 |
| Molecular Formula | C14H19FN2O5 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | ethane;1-[3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-prop-1-ynyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC.CC#CC1(F)C(O)C(CO)OC1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C12H13FN2O5.C2H6/c1-2-4-12(13)9(18)7(6-16)20-10(12)15-5-3-8(17)14-11(15)19;1-2/h3,5,7,9-10,16,18H,6H2,1H3,(H,14,17,19);1-2H3 |
| InChIKey | ADGFREJEDPTNBI-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|