C9H13F2N2O9P — CID 146404049
1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;phosphoric acid (PubChem CID 146404049) has the molecular formula C9H13F2N2O9P and a molecular weight of 362.18 g/mol. Its IUPAC name is 1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;phosphoric acid.
| Compound Name | 1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;phosphoric acid |
|---|---|
| PubChem CID | 146404049 |
| Molecular Formula | C9H13F2N2O9P |
| Molecular Weight | 362.18 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;phosphoric acid |
| SMILES | O=P(O)(O)O.O=c1ccn([C@@H]2O[C@H](CO)[C@@H](O)C2(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C9H10F2N2O5.H3O4P/c10-9(11)6(16)4(3-14)18-7(9)13-2-1-5(15)12-8(13)17;1-5(2,3)4/h1-2,4,6-7,14,16H,3H2,(H,12,15,17);(H3,1,2,3,4)/t4-,6-,7-;/m1./s1 |
| InChIKey | DOAFIPOOPOSOBX-OSZBKLCCSA-N |
| XLogP | -2.51 |
| TPSA | 182.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.18 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|