C9H10F2N2O4S — CID 122453706
1-[(2R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 122453706) has the molecular formula C9H10F2N2O4S and a molecular weight of 280.25 g/mol. Its IUPAC name is 1-[(2R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-[(2R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 122453706 |
| Molecular Formula | C9H10F2N2O4S |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 1-[(2R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | O=c1ccn([C@@H]2O[C@H](CO)C(O)C2(F)F)c(=S)[nH]1 |
| InChI | InChI=1S/C9H10F2N2O4S/c10-9(11)6(16)4(3-14)17-7(9)13-2-1-5(15)12-8(13)18/h1-2,4,6-7,14,16H,3H2,(H,12,15,18)/t4-,6?,7-/m1/s1 |
| InChIKey | UAYYGBULLQFZNQ-ZJXFTUPMSA-N |
| XLogP | -0.21 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|