C12H14N2O6 — CID 123930916
1-[3,4-dihydroxy-5-(hydroxymethyl)-3-prop-1-ynyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 123930916) has the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. Its IUPAC name is 1-[3,4-dihydroxy-5-(hydroxymethyl)-3-prop-1-ynyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[3,4-dihydroxy-5-(hydroxymethyl)-3-prop-1-ynyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 123930916 |
| Molecular Formula | C12H14N2O6 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 1-[3,4-dihydroxy-5-(hydroxymethyl)-3-prop-1-ynyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC#CC1(O)C(O)C(CO)OC1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C12H14N2O6/c1-2-4-12(19)9(17)7(6-15)20-10(12)14-5-3-8(16)13-11(14)18/h3,5,7,9-10,15,17,19H,6H2,1H3,(H,13,16,18) |
| InChIKey | OXBHGCZZADKPMP-UHFFFAOYSA-N |
| XLogP | -2.46 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|