C12H12ClFN2O5 — CID 145393348
1-[(4S)-3-chloro-3-(3-fluoroprop-1-ynyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 145393348) has the molecular formula C12H12ClFN2O5 and a molecular weight of 318.69 g/mol. Its IUPAC name is 1-[(4S)-3-chloro-3-(3-fluoroprop-1-ynyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(4S)-3-chloro-3-(3-fluoroprop-1-ynyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 145393348 |
| Molecular Formula | C12H12ClFN2O5 |
| Molecular Weight | 318.69 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 1-[(4S)-3-chloro-3-(3-fluoroprop-1-ynyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn(C2OC(CO)[C@H](O)C2(Cl)C#CCF)c(=O)[nH]1 |
| InChI | InChI=1S/C12H12ClFN2O5/c13-12(3-1-4-14)9(19)7(6-17)21-10(12)16-5-2-8(18)15-11(16)20/h2,5,7,9-10,17,19H,4,6H2,(H,15,18,20)/t7?,9-,10?,12?/m0/s1 |
| InChIKey | UTGFQDVICCQZAK-XZPLEGQPSA-N |
| XLogP | -1.26 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.69 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|