C12H13ClN2O5 — CID 145393455
1-[3-chloro-4-hydroxy-5-(hydroxymethyl)-3-prop-1-ynyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 145393455) has the molecular formula C12H13ClN2O5 and a molecular weight of 300.70 g/mol. Its IUPAC name is 1-[3-chloro-4-hydroxy-5-(hydroxymethyl)-3-prop-1-ynyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-chloro-4-hydroxy-5-(hydroxymethyl)-3-prop-1-ynyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 145393455 |
| Molecular Formula | C12H13ClN2O5 |
| Molecular Weight | 300.70 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 1-[3-chloro-4-hydroxy-5-(hydroxymethyl)-3-prop-1-ynyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC#CC1(Cl)C(O)C(CO)OC1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C12H13ClN2O5/c1-2-4-12(13)9(18)7(6-16)20-10(12)15-5-3-8(17)14-11(15)19/h3,5,7,9-10,16,18H,6H2,1H3,(H,14,17,19) |
| InChIKey | XNLCFGVJAZCWKI-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.70 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|