C11H12ClN3O5 — CID 145393106
1-[3-amino-3-(2-chloroethynyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 145393106) has the molecular formula C11H12ClN3O5 and a molecular weight of 301.69 g/mol. Its IUPAC name is 1-[3-amino-3-(2-chloroethynyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-amino-3-(2-chloroethynyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 145393106 |
| Molecular Formula | C11H12ClN3O5 |
| Molecular Weight | 301.69 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 1-[3-amino-3-(2-chloroethynyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | NC1(C#CCl)C(O)C(CO)OC1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C11H12ClN3O5/c12-3-2-11(13)8(18)6(5-16)20-9(11)15-4-1-7(17)14-10(15)19/h1,4,6,8-9,16,18H,5,13H2,(H,14,17,19) |
| InChIKey | GVIZWQQWVHQHHU-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 130.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.69 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|