C11H14F2N2O4 — CID 163602182
1-[(2R,3R,4S,5S)-5-ethyl-3,5-difluoro-4-hydroxy-3-methyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 163602182) has the molecular formula C11H14F2N2O4 and a molecular weight of 276.24 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S)-5-ethyl-3,5-difluoro-4-hydroxy-3-methyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5S)-5-ethyl-3,5-difluoro-4-hydroxy-3-methyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163602182 |
| Molecular Formula | C11H14F2N2O4 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 1-[(2R,3R,4S,5S)-5-ethyl-3,5-difluoro-4-hydroxy-3-methyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC[C@@]1(F)O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(F)[C@@H]1O |
| InChI | InChI=1S/C11H14F2N2O4/c1-3-11(13)7(17)10(2,12)8(19-11)15-5-4-6(16)14-9(15)18/h4-5,7-8,17H,3H2,1-2H3,(H,14,16,18)/t7-,8+,10+,11+/m0/s1 |
| InChIKey | GYPHJIFQGAZQQL-SCVMZPAESA-N |
| XLogP | 0.23 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |