C13H17FN2O5 — CID 163548006
1-[(2R,3R,4S,5S)-5-ethyl-5-fluoro-3,4-dihydroxy-3-prop-1-en-2-yloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 163548006) has the molecular formula C13H17FN2O5 and a molecular weight of 300.29 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S)-5-ethyl-5-fluoro-3,4-dihydroxy-3-prop-1-en-2-yloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5S)-5-ethyl-5-fluoro-3,4-dihydroxy-3-prop-1-en-2-yloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163548006 |
| Molecular Formula | C13H17FN2O5 |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 1-[(2R,3R,4S,5S)-5-ethyl-5-fluoro-3,4-dihydroxy-3-prop-1-en-2-yloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C=C(C)[C@]1(O)[C@H](n2ccc(=O)[nH]c2=O)O[C@](F)(CC)[C@H]1O |
| InChI | InChI=1S/C13H17FN2O5/c1-4-12(14)9(18)13(20,7(2)3)10(21-12)16-6-5-8(17)15-11(16)19/h5-6,9-10,18,20H,2,4H2,1,3H3,(H,15,17,19)/t9-,10-,12-,13-/m1/s1 |
| InChIKey | FGRYWFDRTHJWQB-FPQZTECRSA-N |
| XLogP | -0.19 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|