C27H35FN3O10P — CID 126556129
cyclohexyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-4-prop-1-en-2-yloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 126556129) has the molecular formula C27H35FN3O10P and a molecular weight of 611.56 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-4-prop-1-en-2-yloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-4-prop-1-en-2-yloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 126556129 |
| Molecular Formula | C27H35FN3O10P |
| Molecular Weight | 611.56 g/mol |
| Exact Mass | 611.20 |
| IUPAC Name | cyclohexyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxy-4-prop-1-en-2-yloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=C(C)[C@]1(O)[C@H](n2ccc(=O)[nH]c2=O)O[C@](F)(COP(=O)(N[C@@H](C)C(=O)OC2CCCCC2)Oc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C27H35FN3O10P/c1-17(2)27(36)23(34)26(28,40-24(27)31-15-14-21(32)29-25(31)35)16-38-42(37,41-20-12-8-5-9-13-20)30-18(3)22(33)39-19-10-6-4-7-11-19/h5,8-9,12-15,18-19,23-24,34,36H,1,4,6-7,10-11,16H2,2-3H3,(H,30,37)(H,29,32,35)/t18-,23+,24+,26+,27+,42?/m0/s1 |
| InChIKey | IKOZSNHJBQXWBG-BNTRDQJDSA-N |
| XLogP | 2.46 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.56 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|