C26H35FN3O10P — CID 163999848
cyclohexyl (2S)-2-[[cyclohexa-1,3-dien-1-yloxy-[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethenyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy]phosphoryl]amino]propanoate (PubChem CID 163999848) has the molecular formula C26H35FN3O10P and a molecular weight of 599.55 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[cyclohexa-1,3-dien-1-yloxy-[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethenyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy]phosphoryl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[cyclohexa-1,3-dien-1-yloxy-[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethenyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 163999848 |
| Molecular Formula | C26H35FN3O10P |
| Molecular Weight | 599.55 g/mol |
| Exact Mass | 599.20 |
| IUPAC Name | cyclohexyl (2S)-2-[[cyclohexa-1,3-dien-1-yloxy-[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethenyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy]phosphoryl]amino]propanoate |
| SMILES | C=C[C@]1(O)[C@H](n2ccc(=O)[nH]c2=O)O[C@](F)(COP(=O)(N[C@@H](C)C(=O)OC2CCCCC2)OC2=CC=CCC2)[C@H]1O |
| InChI | InChI=1S/C26H35FN3O10P/c1-3-25(35)22(33)26(27,39-23(25)30-15-14-20(31)28-24(30)34)16-37-41(36,40-19-12-8-5-9-13-19)29-17(2)21(32)38-18-10-6-4-7-11-18/h3,5,8,12,14-15,17-18,22-23,33,35H,1,4,6-7,9-11,13,16H2,2H3,(H,29,36)(H,28,31,34)/t17-,22-,23+,25+,26+,41?/m0/s1 |
| InChIKey | UHZVVBRVMSOEAV-BCCSHYKASA-N |
| XLogP | 2.24 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.55 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|