C26H33FN3O11P — CID 86291092
cyclohexyl (2S)-2-[[1,3-benzodioxol-4-yloxy-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate (PubChem CID 86291092) has the molecular formula C26H33FN3O11P and a molecular weight of 613.53 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[1,3-benzodioxol-4-yloxy-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[1,3-benzodioxol-4-yloxy-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 86291092 |
| Molecular Formula | C26H33FN3O11P |
| Molecular Weight | 613.53 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | cyclohexyl (2S)-2-[[1,3-benzodioxol-4-yloxy-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]amino]propanoate |
| SMILES | C[C@H](N[P@](=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(F)[C@@H]1O)Oc1cccc2c1OCO2)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C26H33FN3O11P/c1-15(23(33)39-16-7-4-3-5-8-16)29-42(35,41-18-10-6-9-17-21(18)37-14-36-17)38-13-19-22(32)26(2,27)24(40-19)30-12-11-20(31)28-25(30)34/h6,9-12,15-16,19,22,24,32H,3-5,7-8,13-14H2,1-2H3,(H,29,35)(H,28,31,34)/t15-,19+,22+,24+,26+,42-/m0/s1 |
| InChIKey | ZLPPYKMIBYURGH-QLFYSCKTSA-N |
| XLogP | 2.31 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|