C30H37ClN3O10P — CID 123602950
cyclohexyl 2-[[[4-(2-chloroethyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 123602950) has the molecular formula C30H37ClN3O10P and a molecular weight of 666.06 g/mol. Its IUPAC name is cyclohexyl 2-[[[4-(2-chloroethyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl 2-[[[4-(2-chloroethyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 123602950 |
| Molecular Formula | C30H37ClN3O10P |
| Molecular Weight | 666.06 g/mol |
| Exact Mass | 665.19 |
| IUPAC Name | cyclohexyl 2-[[[4-(2-chloroethyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | CC(NP(=O)(OCC1OC(n2ccc(=O)[nH]c2=O)C(O)(CCCl)C1O)Oc1cccc2ccccc12)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C30H37ClN3O10P/c1-19(27(37)42-21-10-3-2-4-11-21)33-45(40,44-23-13-7-9-20-8-5-6-12-22(20)23)41-18-24-26(36)30(39,15-16-31)28(43-24)34-17-14-25(35)32-29(34)38/h5-9,12-14,17,19,21,24,26,28,36,39H,2-4,10-11,15-16,18H2,1H3,(H,33,40)(H,32,35,38) |
| InChIKey | AFHVOCDAXCVGDD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.06 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|