C25H28BrClN3O9P — CID 126629619
propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-4-bromo-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 126629619) has the molecular formula C25H28BrClN3O9P and a molecular weight of 660.84 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-4-bromo-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-4-bromo-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 126629619 |
| Molecular Formula | C25H28BrClN3O9P |
| Molecular Weight | 660.84 g/mol |
| Exact Mass | 659.04 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-4-bromo-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)N[P@](=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](Cl)(Br)[C@@H]1O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C25H28BrClN3O9P/c1-14(2)37-22(33)15(3)29-40(35,39-18-10-6-8-16-7-4-5-9-17(16)18)36-13-19-21(32)25(26,27)23(38-19)30-12-11-20(31)28-24(30)34/h4-12,14-15,19,21,23,32H,13H2,1-3H3,(H,29,35)(H,28,31,34)/t15-,19+,21+,23+,25-,40-/m0/s1 |
| InChIKey | TURPSZSSRXGGEW-CFFQZQKJSA-N |
| XLogP | 3.41 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.84 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|