C30H34FN4O10P — CID 123587279
propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(5-methyl-6-oxophenanthridin-10-yl)oxyphosphoryl]amino]propanoate (PubChem CID 123587279) has the molecular formula C30H34FN4O10P and a molecular weight of 660.59 g/mol. Its IUPAC name is propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(5-methyl-6-oxophenanthridin-10-yl)oxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(5-methyl-6-oxophenanthridin-10-yl)oxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 123587279 |
| Molecular Formula | C30H34FN4O10P |
| Molecular Weight | 660.59 g/mol |
| Exact Mass | 660.20 |
| IUPAC Name | propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(5-methyl-6-oxophenanthridin-10-yl)oxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(=O)(OCC1OC(n2ccc(=O)[nH]c2=O)C(C)(F)C1O)Oc1cccc2c(=O)n(C)c3ccccc3c12 |
| InChI | InChI=1S/C30H34FN4O10P/c1-16(2)43-27(39)17(3)33-46(41,42-15-22-25(37)30(4,31)28(44-22)35-14-13-23(36)32-29(35)40)45-21-12-8-10-19-24(21)18-9-6-7-11-20(18)34(5)26(19)38/h6-14,16-17,22,25,28,37H,15H2,1-5H3,(H,33,41)(H,32,36,40) |
| InChIKey | PHBRXFJCVCKRKA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 180.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.59 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|