C22H28ClFN3O10P — CID 123583456
propan-2-yl 2-[[[4-chloro-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-(2-methoxyphenoxy)phosphoryl]amino]propanoate (PubChem CID 123583456) has the molecular formula C22H28ClFN3O10P and a molecular weight of 579.90 g/mol. Its IUPAC name is propan-2-yl 2-[[[4-chloro-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-(2-methoxyphenoxy)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[4-chloro-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-(2-methoxyphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 123583456 |
| Molecular Formula | C22H28ClFN3O10P |
| Molecular Weight | 579.90 g/mol |
| Exact Mass | 579.12 |
| IUPAC Name | propan-2-yl 2-[[[4-chloro-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-(2-methoxyphenoxy)phosphoryl]amino]propanoate |
| SMILES | COc1ccccc1OP(=O)(NC(C)C(=O)OC(C)C)OCC1OC(n2ccc(=O)[nH]c2=O)C(F)(Cl)C1O |
| InChI | InChI=1S/C22H28ClFN3O10P/c1-12(2)35-19(30)13(3)26-38(32,37-15-8-6-5-7-14(15)33-4)34-11-16-18(29)22(23,24)20(36-16)27-10-9-17(28)25-21(27)31/h5-10,12-13,16,18,20,29H,11H2,1-4H3,(H,26,32)(H,25,28,31) |
| InChIKey | HVPVDSIRISCBPV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 167.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.90 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|