C22H30ClFN3O10P — CID 130254167
propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-4-chloro-4-fluoro-3-hydroxy-5-(2-hydroxy-6-oxo-1,2-dihydropyrimidin-3-yl)oxolan-2-yl]methoxy-(2-methoxyphenoxy)phosphoryl]amino]propanoate (PubChem CID 130254167) has the molecular formula C22H30ClFN3O10P and a molecular weight of 581.92 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-4-chloro-4-fluoro-3-hydroxy-5-(2-hydroxy-6-oxo-1,2-dihydropyrimidin-3-yl)oxolan-2-yl]methoxy-(2-methoxyphenoxy)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-4-chloro-4-fluoro-3-hydroxy-5-(2-hydroxy-6-oxo-1,2-dihydropyrimidin-3-yl)oxolan-2-yl]methoxy-(2-methoxyphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 130254167 |
| Molecular Formula | C22H30ClFN3O10P |
| Molecular Weight | 581.92 g/mol |
| Exact Mass | 581.13 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-4-chloro-4-fluoro-3-hydroxy-5-(2-hydroxy-6-oxo-1,2-dihydropyrimidin-3-yl)oxolan-2-yl]methoxy-(2-methoxyphenoxy)phosphoryl]amino]propanoate |
| SMILES | COc1ccccc1OP(=O)(N[C@@H](C)C(=O)OC(C)C)OC[C@H]1O[C@@H](N2C=CC(=O)NC2O)[C@@](F)(Cl)[C@@H]1O |
| InChI | InChI=1S/C22H30ClFN3O10P/c1-12(2)35-19(30)13(3)26-38(32,37-15-8-6-5-7-14(15)33-4)34-11-16-18(29)22(23,24)20(36-16)27-10-9-17(28)25-21(27)31/h5-10,12-13,16,18,20-21,29,31H,11H2,1-4H3,(H,25,28)(H,26,32)/t13-,16+,18+,20+,21?,22+,38?/m0/s1 |
| InChIKey | KQIBOUXRJTZVSU-OLAWDTHDSA-N |
| XLogP | 1.34 |
| TPSA | 165.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.92 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|