C22H32N3O9PS — CID 135158128
propan-2-yl (2R)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(2-hydroxy-6-oxo-1,2-dihydropyrimidin-3-yl)-4-methylthiolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 135158128) has the molecular formula C22H32N3O9PS and a molecular weight of 545.55 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(2-hydroxy-6-oxo-1,2-dihydropyrimidin-3-yl)-4-methylthiolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(2-hydroxy-6-oxo-1,2-dihydropyrimidin-3-yl)-4-methylthiolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 135158128 |
| Molecular Formula | C22H32N3O9PS |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(2-hydroxy-6-oxo-1,2-dihydropyrimidin-3-yl)-4-methylthiolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](C)NP(=O)(OC[C@H]1S[C@@H](N2C=CC(=O)NC2O)[C@](C)(O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H32N3O9PS/c1-13(2)33-19(28)14(3)24-35(31,34-15-8-6-5-7-9-15)32-12-16-18(27)22(4,30)20(36-16)25-11-10-17(26)23-21(25)29/h5-11,13-14,16,18,20-21,27,29-30H,12H2,1-4H3,(H,23,26)(H,24,31)/t14-,16-,18-,20-,21?,22-,35?/m1/s1 |
| InChIKey | LGRJKMIZLDNHGL-XHLRSUSJSA-N |
| XLogP | 0.89 |
| TPSA | 166.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|