C18H22NO5P — CID 90392548
propan-2-yl (2S)-2-(diphenoxyphosphorylamino)propanoate (PubChem CID 90392548) has the molecular formula C18H22NO5P and a molecular weight of 363.35 g/mol. Its IUPAC name is propan-2-yl (2S)-2-(diphenoxyphosphorylamino)propanoate.
| Compound Name | propan-2-yl (2S)-2-(diphenoxyphosphorylamino)propanoate |
|---|---|
| PubChem CID | 90392548 |
| Molecular Formula | C18H22NO5P |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | propan-2-yl (2S)-2-(diphenoxyphosphorylamino)propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C18H22NO5P/c1-14(2)22-18(20)15(3)19-25(21,23-16-10-6-4-7-11-16)24-17-12-8-5-9-13-17/h4-15H,1-3H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | NSPCDLIQQUEOKY-HNNXBMFYSA-N |
| XLogP | 4.18 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|