C18H22FN2O5P — CID 145103905
propan-2-yl (2S)-2-[[(4-amino-2-fluorophenoxy)-phenoxyphosphoryl]amino]propanoate (PubChem CID 145103905) has the molecular formula C18H22FN2O5P and a molecular weight of 396.36 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(4-amino-2-fluorophenoxy)-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[(4-amino-2-fluorophenoxy)-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 145103905 |
| Molecular Formula | C18H22FN2O5P |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | propan-2-yl (2S)-2-[[(4-amino-2-fluorophenoxy)-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(Oc1ccccc1)Oc1ccc(N)cc1F |
| InChI | InChI=1S/C18H22FN2O5P/c1-12(2)24-18(22)13(3)21-27(23,25-15-7-5-4-6-8-15)26-17-10-9-14(20)11-16(17)19/h4-13H,20H2,1-3H3,(H,21,23)/t13-,27?/m0/s1 |
| InChIKey | XTLICCKOOJKOKK-NGXIVSIZSA-N |
| XLogP | 3.90 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|