C19H24N2O7P- — CID 163846181
propan-2-yl (2S)-2-[[[4-[methoxy(oxido)amino]phenoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 163846181) has the molecular formula C19H24N2O7P- and a molecular weight of 423.38 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[4-[methoxy(oxido)amino]phenoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[4-[methoxy(oxido)amino]phenoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 163846181 |
| Molecular Formula | C19H24N2O7P- |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | propan-2-yl (2S)-2-[[[4-[methoxy(oxido)amino]phenoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | CON([O-])c1ccc(O[P@@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C19H24N2O7P/c1-14(2)26-19(22)15(3)20-29(24,27-17-8-6-5-7-9-17)28-18-12-10-16(11-13-18)21(23)25-4/h5-15H,1-4H3,(H,20,24)/q-1/t15-,29+/m0/s1 |
| InChIKey | DZONAZGHPQFIQC-PEGYKEAPSA-N |
| XLogP | 4.05 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|