C13H20NO5P — CID 90055745
propan-2-yl (2S)-2-[[methoxy(phenoxy)phosphoryl]amino]propanoate (PubChem CID 90055745) has the molecular formula C13H20NO5P and a molecular weight of 301.28 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[methoxy(phenoxy)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[methoxy(phenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90055745 |
| Molecular Formula | C13H20NO5P |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | propan-2-yl (2S)-2-[[methoxy(phenoxy)phosphoryl]amino]propanoate |
| SMILES | COP(=O)(N[C@@H](C)C(=O)OC(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C13H20NO5P/c1-10(2)18-13(15)11(3)14-20(16,17-4)19-12-8-6-5-7-9-12/h5-11H,1-4H3,(H,14,16)/t11-,20?/m0/s1 |
| InChIKey | BJGSWTZTXRZUKT-ZOZMEPSFSA-N |
| XLogP | 2.75 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|